About 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid
3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid (PubChem CID 87366798) has the molecular formula C23H17N5O7
and a molecular weight of 475.42 g/mol. Its IUPAC name is 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid |
| PubChem CID | 87366798 |
| Molecular Formula | C23H17N5O7 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)n1cnc2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc21 |
| InChI | InChI=1S/C23H17N5O7/c29-22(30)12-20(14-4-2-1-3-5-14)26-13-24-19-7-6-16(10-21(19)26)25-23(31)15-8-17(27(32)33)11-18(9-15)28(34)35/h1-11,13,20H,12H2,(H,25,31)(H,29,30) |
| InChIKey | XSPOPGONRINDAK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid?
The IUPAC name of 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid (CID 87366798) is 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid.
What is the SMILES notation for 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid?
The canonical SMILES for 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid is O=C(O)CC(c1ccccc1)n1cnc2ccc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc21.
What is the InChIKey of 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid?
The InChIKey is XSPOPGONRINDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N5O7/c29-22(30)12-20(14-4-2-1-3-5-14)26-13-24-19-7-6-16(10-21(19)26)25-23(31)15-8-17(27(32)33)11-18(9-15)28(34)35/h1-11,13,20H,12H2,(H,25,31)(H,29,30).
What are the key properties of 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid?
3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid has a molecular weight of 475.42 g/mol, XLogP of 4.17, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[(3,5-dinitrobenzoyl)amino]benzimidazol-1-yl]-3-phenylpropanoic acid is sourced from PubChem (CID 87366798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).