C6H14ClN — CID 87367130
N,N,1,2,2,3,3,4,4,5,5-undecadeuteriocyclohexan-1-amine;hydrochloride (PubChem CID 87367130) has the molecular formula C6H14ClN and a molecular weight of 146.71 g/mol. Its IUPAC name is N,N,1,2,2,3,3,4,4,5,5-undecadeuteriocyclohexan-1-amine;hydrochloride.
| Compound Name | N,N,1,2,2,3,3,4,4,5,5-undecadeuteriocyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 87367130 |
| Molecular Formula | C6H14ClN |
| Molecular Weight | 146.71 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | N,N,1,2,2,3,3,4,4,5,5-undecadeuteriocyclohexan-1-amine;hydrochloride |
| SMILES | Cl.[2H]N([2H])C1([2H])CC([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C6H13N.ClH/c7-6-4-2-1-3-5-6;/h6H,1-5,7H2;1H/i1D2,2D2,3D2,4D2,6D;/hD2 |
| InChIKey | ZJUGSKJHHWASAF-TWWGYSQASA-N |
| XLogP | 1.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.71 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |