About 2-chloro-5-methylpyridine;2-chloropyridine
2-chloro-5-methylpyridine;2-chloropyridine (PubChem CID 87367283) has the molecular formula C11H10Cl2N2
and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine;2-chloropyridine.
Molecular Properties
| Compound Name | 2-chloro-5-methylpyridine;2-chloropyridine |
| PubChem CID | 87367283 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-chloro-5-methylpyridine;2-chloropyridine |
| SMILES | Cc1ccc(Cl)nc1.Clc1ccccn1 |
| InChI | InChI=1S/C6H6ClN.C5H4ClN/c1-5-2-3-6(7)8-4-5;6-5-3-1-2-4-7-5/h2-4H,1H3;1-4H |
| InChIKey | HVDYWTIOEZDHIA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methylpyridine;2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methylpyridine;2-chloropyridine?
The IUPAC name of 2-chloro-5-methylpyridine;2-chloropyridine (CID 87367283) is 2-chloro-5-methylpyridine;2-chloropyridine.
What is the SMILES notation for 2-chloro-5-methylpyridine;2-chloropyridine?
The canonical SMILES for 2-chloro-5-methylpyridine;2-chloropyridine is Cc1ccc(Cl)nc1.Clc1ccccn1.
What is the InChIKey of 2-chloro-5-methylpyridine;2-chloropyridine?
The InChIKey is HVDYWTIOEZDHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C5H4ClN/c1-5-2-3-6(7)8-4-5;6-5-3-1-2-4-7-5/h2-4H,1H3;1-4H.
What are the key properties of 2-chloro-5-methylpyridine;2-chloropyridine?
2-chloro-5-methylpyridine;2-chloropyridine has a molecular weight of 241.12 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methylpyridine;2-chloropyridine is sourced from PubChem (CID 87367283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).