About CID 87367407
CID 87367407 (PubChem CID 87367407) has the molecular formula C3H6O7S2Sr
and a molecular weight of 305.83 g/mol.
Molecular Properties
| Compound Name | CID 87367407 |
| PubChem CID | 87367407 |
| Molecular Formula | C3H6O7S2Sr |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.86 |
| IUPAC Name | — |
| SMILES | O=C(CS(=O)(=O)O)CS(=O)(=O)O.[Sr] |
| InChI | InChI=1S/C3H6O7S2.Sr/c4-3(1-11(5,6)7)2-12(8,9)10;/h1-2H2,(H,5,6,7)(H,8,9,10); |
| InChIKey | PLALEMOPAZEVJE-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 87367407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87367407?
The IUPAC name of CID 87367407 (CID 87367407) is not available.
What is the SMILES notation for CID 87367407?
The canonical SMILES for CID 87367407 is O=C(CS(=O)(=O)O)CS(=O)(=O)O.[Sr].
What is the InChIKey of CID 87367407?
The InChIKey is PLALEMOPAZEVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O7S2.Sr/c4-3(1-11(5,6)7)2-12(8,9)10;/h1-2H2,(H,5,6,7)(H,8,9,10);.
What are the key properties of CID 87367407?
CID 87367407 has a molecular weight of 305.83 g/mol, XLogP of -2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87367407 is sourced from PubChem (CID 87367407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).