bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride

C23H48ClNO2 — CID 87367542

IUPACbis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride
SMILESCCCCCCCC/C=C\CCCCCCCCC[NH+](CCO)CCO.[Cl-]
InChIInChI=1S/C23H47NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(20-22-25)21-23-26;/h9-10,25-26H,2-8,11-23H2,1H3;1H/b10-9-;
InChIKeyOUGNAVMLSROKRX-KVVVOXFISA-N
MW406.10 g/mol
LogP1.29
Rot. Bonds21

About bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride

bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride (PubChem CID 87367542) has the molecular formula C23H48ClNO2 and a molecular weight of 406.10 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride.

Molecular Properties

Compound Namebis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride
PubChem CID87367542
Molecular FormulaC23H48ClNO2
Molecular Weight406.10 g/mol
Exact Mass405.34
IUPAC Namebis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride
SMILESCCCCCCCC/C=C\CCCCCCCCC[NH+](CCO)CCO.[Cl-]
InChIInChI=1S/C23H47NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(20-22-25)21-23-26;/h9-10,25-26H,2-8,11-23H2,1H3;1H/b10-9-;
InChIKeyOUGNAVMLSROKRX-KVVVOXFISA-N
XLogP1.29
TPSA44.90 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds21
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500406.10
LogP ≤ 51.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride?
The IUPAC name of bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride (CID 87367542) is bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride.
What is the SMILES notation for bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride?
The canonical SMILES for bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride is CCCCCCCC/C=C\CCCCCCCCC[NH+](CCO)CCO.[Cl-].
What is the InChIKey of bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride?
The InChIKey is OUGNAVMLSROKRX-KVVVOXFISA-N. The full InChI is InChI=1S/C23H47NO2.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(20-22-25)21-23-26;/h9-10,25-26H,2-8,11-23H2,1H3;1H/b10-9-;.
What are the key properties of bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride?
bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride has a molecular weight of 406.10 g/mol, XLogP of 1.29, 21 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxyethyl)-[(Z)-nonadec-10-enyl]azanium chloride is sourced from PubChem (CID 87367542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).