C22H23N5O4S — CID 87368192
methyl 3-methyl-2-[[3-[4-(phenylcarbamothioylamino)phenyl]-1,2,4-oxadiazole-5-carbonyl]amino]butanoate (PubChem CID 87368192) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl 3-methyl-2-[[3-[4-(phenylcarbamothioylamino)phenyl]-1,2,4-oxadiazole-5-carbonyl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[3-[4-(phenylcarbamothioylamino)phenyl]-1,2,4-oxadiazole-5-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 87368192 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 3-methyl-2-[[3-[4-(phenylcarbamothioylamino)phenyl]-1,2,4-oxadiazole-5-carbonyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1nc(-c2ccc(NC(=S)Nc3ccccc3)cc2)no1)C(C)C |
| InChI | InChI=1S/C22H23N5O4S/c1-13(2)17(21(29)30-3)25-19(28)20-26-18(27-31-20)14-9-11-16(12-10-14)24-22(32)23-15-7-5-4-6-8-15/h4-13,17H,1-3H3,(H,25,28)(H2,23,24,32) |
| InChIKey | CPYGFBMSLTWMQM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|