C18H36B2O6 — CID 87368200
4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]peroxy-1,3,2-dioxaborinane (PubChem CID 87368200) has the molecular formula C18H36B2O6 and a molecular weight of 370.10 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]peroxy-1,3,2-dioxaborinane.
| Compound Name | 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]peroxy-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 87368200 |
| Molecular Formula | C18H36B2O6 |
| Molecular Weight | 370.10 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 4,4,6-trimethyl-2-[2-methyl-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)pentan-2-yl]peroxy-1,3,2-dioxaborinane |
| SMILES | CC1CC(C)(C)OB(OOC(C)(C)CC(C)B2OC(C)CC(C)(C)O2)O1 |
| InChI | InChI=1S/C18H36B2O6/c1-13(19-21-14(2)11-16(4,5)23-19)10-18(8,9)25-26-20-22-15(3)12-17(6,7)24-20/h13-15H,10-12H2,1-9H3 |
| InChIKey | WLYIZHUANGVQSL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.10 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|