C38H49FN2O5Si — CID 87368640
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoro-2-(propan-2-ylideneamino)oxyphenyl]-(oxan-4-yl)methanone (PubChem CID 87368640) has the molecular formula C38H49FN2O5Si and a molecular weight of 660.90 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoro-2-(propan-2-ylideneamino)oxyphenyl]-(oxan-4-yl)methanone.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoro-2-(propan-2-ylideneamino)oxyphenyl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 87368640 |
| Molecular Formula | C38H49FN2O5Si |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.34 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-fluoro-2-(propan-2-ylideneamino)oxyphenyl]-(oxan-4-yl)methanone |
| SMILES | CC(C)=NOc1c(C(=O)C2CCOCC2)cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(N2C[C@@H](C)O[C@@H](C)C2)c1F |
| InChI | InChI=1S/C38H49FN2O5Si/c1-26(2)40-46-37-33(36(42)29-18-20-43-21-19-29)22-30(35(34(37)39)41-23-27(3)45-28(4)24-41)25-44-47(38(5,6)7,31-14-10-8-11-15-31)32-16-12-9-13-17-32/h8-17,22,27-29H,18-21,23-25H2,1-7H3/t27-,28+ |
| InChIKey | JJCNEZGYTIWCGZ-HNRBIFIRSA-N |
| XLogP | 6.90 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|