C14H18N4O5 — CID 87368815
(1,4-dimethylpiperazin-2-yl) N-formyl-N-(3-nitrophenyl)carbamate (PubChem CID 87368815) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is (1,4-dimethylpiperazin-2-yl) N-formyl-N-(3-nitrophenyl)carbamate.
| Compound Name | (1,4-dimethylpiperazin-2-yl) N-formyl-N-(3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 87368815 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (1,4-dimethylpiperazin-2-yl) N-formyl-N-(3-nitrophenyl)carbamate |
| SMILES | CN1CCN(C)C(OC(=O)N(C=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C14H18N4O5/c1-15-6-7-16(2)13(9-15)23-14(20)17(10-19)11-4-3-5-12(8-11)18(21)22/h3-5,8,10,13H,6-7,9H2,1-2H3 |
| InChIKey | KXOVEBVHVIFPNJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|