C19H18F2N2O3 — CID 87369152
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(pyridine-2-carbonyl)benzaldehyde (PubChem CID 87369152) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(pyridine-2-carbonyl)benzaldehyde.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(pyridine-2-carbonyl)benzaldehyde |
|---|---|
| PubChem CID | 87369152 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(pyridine-2-carbonyl)benzaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc(C(=O)c3ccccn3)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C19H18F2N2O3/c1-11-8-23(9-12(2)26-11)18-13(10-24)7-14(16(20)17(18)21)19(25)15-5-3-4-6-22-15/h3-7,10-12H,8-9H2,1-2H3/t11-,12+ |
| InChIKey | CVKPFFQTTZGGAX-TXEJJXNPSA-N |
| XLogP | 3.02 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|