C8H10O2 — CID 87369437
3,4,4a,5-tetrahydro-1,2-benzodioxine (PubChem CID 87369437) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-1,2-benzodioxine.
| Compound Name | 3,4,4a,5-tetrahydro-1,2-benzodioxine |
|---|---|
| PubChem CID | 87369437 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 3,4,4a,5-tetrahydro-1,2-benzodioxine |
| SMILES | C1=CCC2CCOOC2=C1 |
| InChI | InChI=1S/C8H10O2/c1-2-4-8-7(3-1)5-6-9-10-8/h1-2,4,7H,3,5-6H2 |
| InChIKey | PACHNRJINAWOOL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|