C32H38O6Si — CID 87369523
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 87369523) has the molecular formula C32H38O6Si and a molecular weight of 546.74 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 87369523 |
| Molecular Formula | C32H38O6Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | CC1(C)OC2OC(C=O)(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(OCc3ccccc3)C2O1 |
| InChI | InChI=1S/C32H38O6Si/c1-30(2,3)39(25-17-11-7-12-18-25,26-19-13-8-14-20-26)35-23-32(22-33)28(34-21-24-15-9-6-10-16-24)27-29(38-32)37-31(4,5)36-27/h6-20,22,27-29H,21,23H2,1-5H3 |
| InChIKey | IWNVDBLDFCVOSN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|