C17H20F3NO5 — CID 87370135
ethyl (2S)-2-[[(2S)-1-oxo-1-(2,2,2-trifluoroacetyl)oxypropan-2-yl]amino]-4-phenylbutanoate (PubChem CID 87370135) has the molecular formula C17H20F3NO5 and a molecular weight of 375.34 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-1-oxo-1-(2,2,2-trifluoroacetyl)oxypropan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-1-oxo-1-(2,2,2-trifluoroacetyl)oxypropan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 87370135 |
| Molecular Formula | C17H20F3NO5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-1-oxo-1-(2,2,2-trifluoroacetyl)oxypropan-2-yl]amino]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO5/c1-3-25-15(23)13(10-9-12-7-5-4-6-8-12)21-11(2)14(22)26-16(24)17(18,19)20/h4-8,11,13,21H,3,9-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | NGLDPSARCLHYCM-AAEUAGOBSA-N |
| XLogP | 2.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|