C18H2Cl10I2O — CID 87370423
1,2,3,4,5-pentachloro-6-[3-iodo-1-[3-iodo-1-(2,3,4,5,6-pentachlorophenyl)prop-2-ynoxy]prop-2-ynyl]benzene (PubChem CID 87370423) has the molecular formula C18H2Cl10I2O and a molecular weight of 842.55 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[3-iodo-1-[3-iodo-1-(2,3,4,5,6-pentachlorophenyl)prop-2-ynoxy]prop-2-ynyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[3-iodo-1-[3-iodo-1-(2,3,4,5,6-pentachlorophenyl)prop-2-ynoxy]prop-2-ynyl]benzene |
|---|---|
| PubChem CID | 87370423 |
| Molecular Formula | C18H2Cl10I2O |
| Molecular Weight | 842.55 g/mol |
| Exact Mass | 837.51 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[3-iodo-1-[3-iodo-1-(2,3,4,5,6-pentachlorophenyl)prop-2-ynoxy]prop-2-ynyl]benzene |
| SMILES | Clc1c(Cl)c(Cl)c(C(C#CI)OC(C#CI)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H2Cl10I2O/c19-9-7(10(20)14(24)17(27)13(9)23)5(1-3-29)31-6(2-4-30)8-11(21)15(25)18(28)16(26)12(8)22/h5-6H |
| InChIKey | AJIYSROYADYYTB-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.55 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|