About 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone
2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone (PubChem CID 87370624) has the molecular formula C12H6BrF4NO2
and a molecular weight of 352.08 g/mol. Its IUPAC name is 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone |
| PubChem CID | 87370624 |
| Molecular Formula | C12H6BrF4NO2 |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone |
| SMILES | O=C(CBr)c1c(-c2cccc(F)c2)noc1C(F)(F)F |
| InChI | InChI=1S/C12H6BrF4NO2/c13-5-8(19)9-10(6-2-1-3-7(14)4-6)18-20-11(9)12(15,16)17/h1-4H,5H2 |
| InChIKey | HVLCIMJGQAVZSZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone?
The IUPAC name of 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone (CID 87370624) is 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone.
What is the SMILES notation for 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone?
The canonical SMILES for 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone is O=C(CBr)c1c(-c2cccc(F)c2)noc1C(F)(F)F.
What is the InChIKey of 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone?
The InChIKey is HVLCIMJGQAVZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrF4NO2/c13-5-8(19)9-10(6-2-1-3-7(14)4-6)18-20-11(9)12(15,16)17/h1-4H,5H2.
What are the key properties of 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone?
2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone has a molecular weight of 352.08 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[3-(3-fluorophenyl)-5-(trifluoromethyl)-1,2-oxazol-4-yl]ethanone is sourced from PubChem (CID 87370624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).