About azane;propane;pyrene
azane;propane;pyrene (PubChem CID 87370632) has the molecular formula C19H21N
and a molecular weight of 263.38 g/mol. Its IUPAC name is azane;propane;pyrene.
Molecular Properties
| Compound Name | azane;propane;pyrene |
| PubChem CID | 87370632 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | azane;propane;pyrene |
| SMILES | CCC.N.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C3H8.H3N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-2;/h1-10H;3H2,1-2H3;1H3 |
| InChIKey | BYFYIKOGPZHEBQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze azane;propane;pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propane;pyrene?
The IUPAC name of azane;propane;pyrene (CID 87370632) is azane;propane;pyrene.
What is the SMILES notation for azane;propane;pyrene?
The canonical SMILES for azane;propane;pyrene is CCC.N.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of azane;propane;pyrene?
The InChIKey is BYFYIKOGPZHEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C3H8.H3N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-2;/h1-10H;3H2,1-2H3;1H3.
What are the key properties of azane;propane;pyrene?
azane;propane;pyrene has a molecular weight of 263.38 g/mol, XLogP of 6.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propane;pyrene is sourced from PubChem (CID 87370632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).