About 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane
3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane (PubChem CID 87370746) has the molecular formula C13H35NO6Si2
and a molecular weight of 357.60 g/mol. Its IUPAC name is 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane |
| PubChem CID | 87370746 |
| Molecular Formula | C13H35NO6Si2 |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane |
| SMILES | CCO[Si](CCCN)(OCC)OCC.CO[Si](C)(OC)OC |
| InChI | InChI=1S/C9H23NO3Si.C4H12O3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5-8(4,6-2)7-3/h4-10H2,1-3H3;1-4H3 |
| InChIKey | UWFGXDJELRTBET-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane?
The IUPAC name of 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane (CID 87370746) is 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane.
What is the SMILES notation for 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane?
The canonical SMILES for 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane is CCO[Si](CCCN)(OCC)OCC.CO[Si](C)(OC)OC.
What is the InChIKey of 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane?
The InChIKey is UWFGXDJELRTBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.C4H12O3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5-8(4,6-2)7-3/h4-10H2,1-3H3;1-4H3.
What are the key properties of 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane?
3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane has a molecular weight of 357.60 g/mol, XLogP of 1.88, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-triethoxysilylpropan-1-amine;trimethoxy(methyl)silane is sourced from PubChem (CID 87370746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).