C6H3F9 — CID 87370850
(E)-1,1,1,3,5,5,6,6,6-nonafluorohex-2-ene (PubChem CID 87370850) has the molecular formula C6H3F9 and a molecular weight of 246.07 g/mol. Its IUPAC name is (E)-1,1,1,3,5,5,6,6,6-nonafluorohex-2-ene.
| Compound Name | (E)-1,1,1,3,5,5,6,6,6-nonafluorohex-2-ene |
|---|---|
| PubChem CID | 87370850 |
| Molecular Formula | C6H3F9 |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | (E)-1,1,1,3,5,5,6,6,6-nonafluorohex-2-ene |
| SMILES | F/C(=C/C(F)(F)F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F9/c7-3(2-5(10,11)12)1-4(8,9)6(13,14)15/h2H,1H2/b3-2+ |
| InChIKey | JVLSYKLERHAWTJ-NSCUHMNNSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|