About 3,5-dibromo-N,N-diethylpyrazin-2-amine
3,5-dibromo-N,N-diethylpyrazin-2-amine (PubChem CID 87371010) has the molecular formula C8H11Br2N3
and a molecular weight of 309.01 g/mol. Its IUPAC name is 3,5-dibromo-N,N-diethylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3,5-dibromo-N,N-diethylpyrazin-2-amine |
| PubChem CID | 87371010 |
| Molecular Formula | C8H11Br2N3 |
| Molecular Weight | 309.01 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 3,5-dibromo-N,N-diethylpyrazin-2-amine |
| SMILES | CCN(CC)c1ncc(Br)nc1Br |
| InChI | InChI=1S/C8H11Br2N3/c1-3-13(4-2)8-7(10)12-6(9)5-11-8/h5H,3-4H2,1-2H3 |
| InChIKey | WGTPQLVSXKMUJE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.01 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromo-N,N-diethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-N,N-diethylpyrazin-2-amine?
The IUPAC name of 3,5-dibromo-N,N-diethylpyrazin-2-amine (CID 87371010) is 3,5-dibromo-N,N-diethylpyrazin-2-amine.
What is the SMILES notation for 3,5-dibromo-N,N-diethylpyrazin-2-amine?
The canonical SMILES for 3,5-dibromo-N,N-diethylpyrazin-2-amine is CCN(CC)c1ncc(Br)nc1Br.
What is the InChIKey of 3,5-dibromo-N,N-diethylpyrazin-2-amine?
The InChIKey is WGTPQLVSXKMUJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Br2N3/c1-3-13(4-2)8-7(10)12-6(9)5-11-8/h5H,3-4H2,1-2H3.
What are the key properties of 3,5-dibromo-N,N-diethylpyrazin-2-amine?
3,5-dibromo-N,N-diethylpyrazin-2-amine has a molecular weight of 309.01 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-N,N-diethylpyrazin-2-amine is sourced from PubChem (CID 87371010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).