C33H26Cl2F4N10O4 — CID 87371179
4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine;4-(2-chloro-4-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 87371179) has the molecular formula C33H26Cl2F4N10O4 and a molecular weight of 773.53 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine;4-(2-chloro-4-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine;4-(2-chloro-4-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 87371179 |
| Molecular Formula | C33H26Cl2F4N10O4 |
| Molecular Weight | 773.53 g/mol |
| Exact Mass | 772.15 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3,5-triazin-2-amine;4-(2-chloro-4-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(Nc2ncnc(-c3ccnc(Cl)c3)n2)cc(OC)c1OC.FC(F)C(F)(F)Oc1cccc(Nc2ncnc(-c3ccnc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C17H16ClN5O3.C16H10ClF4N5O/c1-24-12-7-11(8-13(25-2)15(12)26-3)22-17-21-9-20-16(23-17)10-4-5-19-14(18)6-10;17-12-6-9(4-5-22-12)13-23-8-24-15(26-13)25-10-2-1-3-11(7-10)27-16(20,21)14(18)19/h4-9H,1-3H3,(H,20,21,22,23);1-8,14H,(H,23,24,25,26) |
| InChIKey | LXFJGICSKJPVDZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 164.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.53 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|