C15H10ClF2N5 — CID 87371295
6-(2-chloro-6-methyl-4-pyridinyl)-5-(2,5-difluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 87371295) has the molecular formula C15H10ClF2N5 and a molecular weight of 333.73 g/mol. Its IUPAC name is 6-(2-chloro-6-methyl-4-pyridinyl)-5-(2,5-difluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 6-(2-chloro-6-methyl-4-pyridinyl)-5-(2,5-difluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 87371295 |
| Molecular Formula | C15H10ClF2N5 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 6-(2-chloro-6-methyl-4-pyridinyl)-5-(2,5-difluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1cc(-c2nnc(N)nc2-c2cc(F)ccc2F)cc(Cl)n1 |
| InChI | InChI=1S/C15H10ClF2N5/c1-7-4-8(5-12(16)20-7)13-14(21-15(19)23-22-13)10-6-9(17)2-3-11(10)18/h2-6H,1H3,(H2,19,21,23) |
| InChIKey | CJMZQEWZWDXVRC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|