About nonan-5-yl(nonoxy)tin
nonan-5-yl(nonoxy)tin (PubChem CID 87371420) has the molecular formula C18H38OSn
and a molecular weight of 389.21 g/mol. Its IUPAC name is nonan-5-yl(nonoxy)tin.
Molecular Properties
| Compound Name | nonan-5-yl(nonoxy)tin |
| PubChem CID | 87371420 |
| Molecular Formula | C18H38OSn |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | nonan-5-yl(nonoxy)tin |
| SMILES | CCCCCCCCCO[Sn]C(CCCC)CCCC |
| InChI | InChI=1S/C9H19O.C9H19.Sn/c1-2-3-4-5-6-7-8-9-10;1-3-5-7-9-8-6-4-2;/h2-9H2,1H3;9H,3-8H2,1-2H3;/q-1;;+1 |
| InChIKey | FKIAXPMSYNEGRS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-5-yl(nonoxy)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-5-yl(nonoxy)tin?
The IUPAC name of nonan-5-yl(nonoxy)tin (CID 87371420) is nonan-5-yl(nonoxy)tin.
What is the SMILES notation for nonan-5-yl(nonoxy)tin?
The canonical SMILES for nonan-5-yl(nonoxy)tin is CCCCCCCCCO[Sn]C(CCCC)CCCC.
What is the InChIKey of nonan-5-yl(nonoxy)tin?
The InChIKey is FKIAXPMSYNEGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19O.C9H19.Sn/c1-2-3-4-5-6-7-8-9-10;1-3-5-7-9-8-6-4-2;/h2-9H2,1H3;9H,3-8H2,1-2H3;/q-1;;+1.
What are the key properties of nonan-5-yl(nonoxy)tin?
nonan-5-yl(nonoxy)tin has a molecular weight of 389.21 g/mol, XLogP of 6.54, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-5-yl(nonoxy)tin is sourced from PubChem (CID 87371420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).