C29H33ClN6O7S — CID 87371658
N-[(Z)-[4-[[[2-chloro-5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]carbamoyl]phenyl]sulfonylamino]methyl]benzoyl]oxymethoxydiazenyl]-N-ethylethanamine oxide (PubChem CID 87371658) has the molecular formula C29H33ClN6O7S and a molecular weight of 645.14 g/mol. Its IUPAC name is N-[(Z)-[4-[[[2-chloro-5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]carbamoyl]phenyl]sulfonylamino]methyl]benzoyl]oxymethoxydiazenyl]-N-ethylethanamine oxide.
| Compound Name | N-[(Z)-[4-[[[2-chloro-5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]carbamoyl]phenyl]sulfonylamino]methyl]benzoyl]oxymethoxydiazenyl]-N-ethylethanamine oxide |
|---|---|
| PubChem CID | 87371658 |
| Molecular Formula | C29H33ClN6O7S |
| Molecular Weight | 645.14 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | N-[(Z)-[4-[[[2-chloro-5-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]carbamoyl]phenyl]sulfonylamino]methyl]benzoyl]oxymethoxydiazenyl]-N-ethylethanamine oxide |
| SMILES | CC[N+]([O-])(CC)/N=N\OCOC(=O)c1ccc(CNS(=O)(=O)c2cc(C(=O)NN3c4ccccc4C[C@H]3C)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H33ClN6O7S/c1-4-36(39,5-2)33-34-43-19-42-29(38)22-12-10-21(11-13-22)18-31-44(40,41)27-17-24(14-15-25(27)30)28(37)32-35-20(3)16-23-8-6-7-9-26(23)35/h6-15,17,20,31H,4-5,16,18-19H2,1-3H3,(H,32,37)/b34-33-/t20-/m1/s1 |
| InChIKey | BESAJYFGWOVNAW-YUZHXUEKSA-N |
| XLogP | 4.68 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|