C22H22F10O2Sn — CID 87372428
bis(1,1,4,4,4-pentafluorobutyl)-bis(phenylmethoxy)stannane (PubChem CID 87372428) has the molecular formula C22H22F10O2Sn and a molecular weight of 627.11 g/mol. Its IUPAC name is bis(1,1,4,4,4-pentafluorobutyl)-bis(phenylmethoxy)stannane.
| Compound Name | bis(1,1,4,4,4-pentafluorobutyl)-bis(phenylmethoxy)stannane |
|---|---|
| PubChem CID | 87372428 |
| Molecular Formula | C22H22F10O2Sn |
| Molecular Weight | 627.11 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | bis(1,1,4,4,4-pentafluorobutyl)-bis(phenylmethoxy)stannane |
| SMILES | FC(F)(F)CCC(F)(F)[Sn](OCc1ccccc1)(OCc1ccccc1)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/2C7H7O.2C4H4F5.Sn/c2*8-6-7-4-2-1-3-5-7;2*5-3(6)1-2-4(7,8)9;/h2*1-5H,6H2;2*1-2H2;/q2*-1;;;+2 |
| InChIKey | KRRKAYMPNRYCAM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.11 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |