About methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid
methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid (PubChem CID 87372551) has the molecular formula C6H12O5S
and a molecular weight of 196.22 g/mol. Its IUPAC name is methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid.
Molecular Properties
| Compound Name | methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid |
| PubChem CID | 87372551 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid |
| SMILES | C.CC1(C(=O)O)CCS(=O)(=O)O1 |
| InChI | InChI=1S/C5H8O5S.CH4/c1-5(4(6)7)2-3-11(8,9)10-5;/h2-3H2,1H3,(H,6,7);1H4 |
| InChIKey | BCNYNPVKDMZOAO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid?
The IUPAC name of methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid (CID 87372551) is methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid.
What is the SMILES notation for methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid?
The canonical SMILES for methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid is C.CC1(C(=O)O)CCS(=O)(=O)O1.
What is the InChIKey of methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid?
The InChIKey is BCNYNPVKDMZOAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O5S.CH4/c1-5(4(6)7)2-3-11(8,9)10-5;/h2-3H2,1H3,(H,6,7);1H4.
What are the key properties of methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid?
methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid has a molecular weight of 196.22 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methyl-2,2-dioxooxathiolane-5-carboxylic acid is sourced from PubChem (CID 87372551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).