About ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane
ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane (PubChem CID 87372684) has the molecular formula C6H13F3O3Si
and a molecular weight of 218.25 g/mol. Its IUPAC name is ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane.
Molecular Properties
| Compound Name | ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane |
| PubChem CID | 87372684 |
| Molecular Formula | C6H13F3O3Si |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane |
| SMILES | CC[Si](OC)(OC)OCC(F)(F)F |
| InChI | InChI=1S/C6H13F3O3Si/c1-4-13(10-2,11-3)12-5-6(7,8)9/h4-5H2,1-3H3 |
| InChIKey | OOCHRDQHTSHBJV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane?
The IUPAC name of ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane (CID 87372684) is ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane.
What is the SMILES notation for ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane?
The canonical SMILES for ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane is CC[Si](OC)(OC)OCC(F)(F)F.
What is the InChIKey of ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane?
The InChIKey is OOCHRDQHTSHBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O3Si/c1-4-13(10-2,11-3)12-5-6(7,8)9/h4-5H2,1-3H3.
What are the key properties of ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane?
ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane has a molecular weight of 218.25 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethoxy-(2,2,2-trifluoroethoxy)silane is sourced from PubChem (CID 87372684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).