C15H20F6O3 — CID 87373484
(E)-4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoic acid (PubChem CID 87373484) has the molecular formula C15H20F6O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is (E)-4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoic acid.
| Compound Name | (E)-4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoic acid |
|---|---|
| PubChem CID | 87373484 |
| Molecular Formula | C15H20F6O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (E)-4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoic acid |
| SMILES | C/C(=C\C(CC(O)(C(F)(F)F)C(F)(F)F)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C15H20F6O3/c1-9(12(22)23)7-11(10-5-3-2-4-6-10)8-13(24,14(16,17)18)15(19,20)21/h7,10-11,24H,2-6,8H2,1H3,(H,22,23)/b9-7+ |
| InChIKey | ATLNAQPANGLXJF-VQHVLOKHSA-N |
| XLogP | 4.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|