C22H22N4O2S2 — CID 87373984
N-[4-[[3-benzyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide (PubChem CID 87373984) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-[4-[[3-benzyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide.
| Compound Name | N-[4-[[3-benzyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 87373984 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[4-[[3-benzyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C2/SC(=C3SCCN3C)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-15(27)23-17-8-10-18(11-9-17)24-22-26(14-16-6-4-3-5-7-16)20(28)19(30-22)21-25(2)12-13-29-21/h3-11H,12-14H2,1-2H3,(H,23,27)/b21-19?,24-22+ |
| InChIKey | ICGLFCAYQVGONK-PHYNDCCTSA-N |
| XLogP | 4.26 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|