About acetic acid;didecyl(dimethyl)azanium
acetic acid;didecyl(dimethyl)azanium (PubChem CID 87374171) has the molecular formula C24H52NO2+
and a molecular weight of 386.69 g/mol. Its IUPAC name is acetic acid;didecyl(dimethyl)azanium.
Molecular Properties
| Compound Name | acetic acid;didecyl(dimethyl)azanium |
| PubChem CID | 87374171 |
| Molecular Formula | C24H52NO2+ |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 386.40 |
| IUPAC Name | acetic acid;didecyl(dimethyl)azanium |
| SMILES | CC(=O)O.CCCCCCCCCC[N+](C)(C)CCCCCCCCCC |
| InChI | InChI=1S/C22H48N.C2H4O2/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2(3)4/h5-22H2,1-4H3;1H3,(H,3,4)/q+1; |
| InChIKey | XPZLPHAUBUNMEN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;didecyl(dimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;didecyl(dimethyl)azanium?
The IUPAC name of acetic acid;didecyl(dimethyl)azanium (CID 87374171) is acetic acid;didecyl(dimethyl)azanium.
What is the SMILES notation for acetic acid;didecyl(dimethyl)azanium?
The canonical SMILES for acetic acid;didecyl(dimethyl)azanium is CC(=O)O.CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.
What is the InChIKey of acetic acid;didecyl(dimethyl)azanium?
The InChIKey is XPZLPHAUBUNMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N.C2H4O2/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;1-2(3)4/h5-22H2,1-4H3;1H3,(H,3,4)/q+1;.
What are the key properties of acetic acid;didecyl(dimethyl)azanium?
acetic acid;didecyl(dimethyl)azanium has a molecular weight of 386.69 g/mol, XLogP of 7.44, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;didecyl(dimethyl)azanium is sourced from PubChem (CID 87374171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).