C8H10O — CID 87374397
1,2,3,4-tetradeuterio-5-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)benzene (PubChem CID 87374397) has the molecular formula C8H10O and a molecular weight of 131.22 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-5-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)benzene.
| Compound Name | 1,2,3,4-tetradeuterio-5-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)benzene |
|---|---|
| PubChem CID | 87374397 |
| Molecular Formula | C8H10O |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 1,2,3,4-tetradeuterio-5-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)benzene |
| SMILES | [2H]OC([2H])([2H])C([2H])([2H])c1cc([2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i1D,2D,3D,4D,6D2,7D2,9D |
| InChIKey | WRMNZCZEMHIOCP-WNHDVZOGSA-N |
| XLogP | 1.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |