C19H22Cl2N2O2S — CID 87374442
4-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-(2-methylcyclohexyl)benzenesulfonamide (PubChem CID 87374442) has the molecular formula C19H22Cl2N2O2S and a molecular weight of 413.37 g/mol. Its IUPAC name is 4-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-(2-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-(2-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87374442 |
| Molecular Formula | C19H22Cl2N2O2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-chloro-N-[(6-chloro-3-pyridinyl)methyl]-N-(2-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCCCC1N(Cc1ccc(Cl)nc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O2S/c1-14-4-2-3-5-18(14)23(13-15-6-11-19(21)22-12-15)26(24,25)17-9-7-16(20)8-10-17/h6-12,14,18H,2-5,13H2,1H3 |
| InChIKey | NMUVEKMGKRSDCV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|