About tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate
tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 87374706) has the molecular formula C15H25N3O4
and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| PubChem CID | 87374706 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | C#CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O4/c1-8-9-10-16-11(17-12(19)21-14(2,3)4)18-13(20)22-15(5,6)7/h1H,9-10H2,2-7H3,(H2,16,17,18,19,20) |
| InChIKey | QUDUFINSFSBXSU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate?
The IUPAC name of tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (CID 87374706) is tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
What is the SMILES notation for tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate?
The canonical SMILES for tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate is C#CCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate?
The InChIKey is QUDUFINSFSBXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O4/c1-8-9-10-16-11(17-12(19)21-14(2,3)4)18-13(20)22-15(5,6)7/h1H,9-10H2,2-7H3,(H2,16,17,18,19,20).
What are the key properties of tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate?
tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate has a molecular weight of 311.38 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[N'-but-3-ynyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate is sourced from PubChem (CID 87374706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).