About butyl(methyl)tin;1-heptoxyheptane
butyl(methyl)tin;1-heptoxyheptane (PubChem CID 87375553) has the molecular formula C19H42OSn
and a molecular weight of 405.26 g/mol. Its IUPAC name is butyl(methyl)tin;1-heptoxyheptane.
Molecular Properties
| Compound Name | butyl(methyl)tin;1-heptoxyheptane |
| PubChem CID | 87375553 |
| Molecular Formula | C19H42OSn |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | butyl(methyl)tin;1-heptoxyheptane |
| SMILES | CCCCCCCOCCCCCCC.CCCC[Sn]C |
| InChI | InChI=1S/C14H30O.C4H9.CH3.Sn/c1-3-5-7-9-11-13-15-14-12-10-8-6-4-2;1-3-4-2;;/h3-14H2,1-2H3;1,3-4H2,2H3;1H3; |
| InChIKey | NYYMIRJYSAHFPH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(methyl)tin;1-heptoxyheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(methyl)tin;1-heptoxyheptane?
The IUPAC name of butyl(methyl)tin;1-heptoxyheptane (CID 87375553) is butyl(methyl)tin;1-heptoxyheptane.
What is the SMILES notation for butyl(methyl)tin;1-heptoxyheptane?
The canonical SMILES for butyl(methyl)tin;1-heptoxyheptane is CCCCCCCOCCCCCCC.CCCC[Sn]C.
What is the InChIKey of butyl(methyl)tin;1-heptoxyheptane?
The InChIKey is NYYMIRJYSAHFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O.C4H9.CH3.Sn/c1-3-5-7-9-11-13-15-14-12-10-8-6-4-2;1-3-4-2;;/h3-14H2,1-2H3;1,3-4H2,2H3;1H3;.
What are the key properties of butyl(methyl)tin;1-heptoxyheptane?
butyl(methyl)tin;1-heptoxyheptane has a molecular weight of 405.26 g/mol, XLogP of 6.90, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(methyl)tin;1-heptoxyheptane is sourced from PubChem (CID 87375553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).