C10H22O8P2 — CID 87375656
[2-ethoxy-1-[hydroxy(propoxy)phosphoryl]-2-oxoethyl]-propoxyphosphinic acid (PubChem CID 87375656) has the molecular formula C10H22O8P2 and a molecular weight of 332.23 g/mol. Its IUPAC name is [2-ethoxy-1-[hydroxy(propoxy)phosphoryl]-2-oxoethyl]-propoxyphosphinic acid.
| Compound Name | [2-ethoxy-1-[hydroxy(propoxy)phosphoryl]-2-oxoethyl]-propoxyphosphinic acid |
|---|---|
| PubChem CID | 87375656 |
| Molecular Formula | C10H22O8P2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [2-ethoxy-1-[hydroxy(propoxy)phosphoryl]-2-oxoethyl]-propoxyphosphinic acid |
| SMILES | CCCOP(=O)(O)C(C(=O)OCC)P(=O)(O)OCCC |
| InChI | InChI=1S/C10H22O8P2/c1-4-7-17-19(12,13)10(9(11)16-6-3)20(14,15)18-8-5-2/h10H,4-8H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | CVNAQAAPWXHTSG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|