C21H23F3NO5P — CID 87376019
[2-(3-aminophenyl)-3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]-(4-phenylbutyl)phosphinic acid (PubChem CID 87376019) has the molecular formula C21H23F3NO5P and a molecular weight of 457.39 g/mol. Its IUPAC name is [2-(3-aminophenyl)-3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]-(4-phenylbutyl)phosphinic acid.
| Compound Name | [2-(3-aminophenyl)-3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]-(4-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 87376019 |
| Molecular Formula | C21H23F3NO5P |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [2-(3-aminophenyl)-3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]-(4-phenylbutyl)phosphinic acid |
| SMILES | Nc1cccc(C(CP(=O)(O)CCCCc2ccccc2)C(=O)OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3NO5P/c22-21(23,24)20(27)30-19(26)18(16-10-6-11-17(25)13-16)14-31(28,29)12-5-4-9-15-7-2-1-3-8-15/h1-3,6-8,10-11,13,18H,4-5,9,12,14,25H2,(H,28,29) |
| InChIKey | IDKKFXZHIYTZEM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|