About 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol
2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol (PubChem CID 87376207) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol |
| PubChem CID | 87376207 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol |
| SMILES | CC1CN(CCO)CC(C)N1N=O |
| InChI | InChI=1S/C8H17N3O2/c1-7-5-10(3-4-12)6-8(2)11(7)9-13/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | KTIWEQDVVMNSMO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol?
The IUPAC name of 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol (CID 87376207) is 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol.
What is the SMILES notation for 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol?
The canonical SMILES for 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol is CC1CN(CCO)CC(C)N1N=O.
What is the InChIKey of 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol?
The InChIKey is KTIWEQDVVMNSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-7-5-10(3-4-12)6-8(2)11(7)9-13/h7-8,12H,3-6H2,1-2H3.
What are the key properties of 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol?
2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol has a molecular weight of 187.24 g/mol, XLogP of 0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-4-nitrosopiperazin-1-yl)ethanol is sourced from PubChem (CID 87376207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).