About 1-diazo-8a,9a-dihydro-4H-fluoren-9-one
1-diazo-8a,9a-dihydro-4H-fluoren-9-one (PubChem CID 87376395) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-diazo-8a,9a-dihydro-4H-fluoren-9-one.
Molecular Properties
| Compound Name | 1-diazo-8a,9a-dihydro-4H-fluoren-9-one |
| PubChem CID | 87376395 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-diazo-8a,9a-dihydro-4H-fluoren-9-one |
| SMILES | [N-]=[N+]=C1C=CCC2=C3C=CC=CC3C(=O)C12 |
| InChI | InChI=1S/C13H10N2O/c14-15-11-7-3-6-9-8-4-1-2-5-10(8)13(16)12(9)11/h1-5,7,10,12H,6H2 |
| InChIKey | UJFVOCITFITNSG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-8a,9a-dihydro-4H-fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-8a,9a-dihydro-4H-fluoren-9-one?
The IUPAC name of 1-diazo-8a,9a-dihydro-4H-fluoren-9-one (CID 87376395) is 1-diazo-8a,9a-dihydro-4H-fluoren-9-one.
What is the SMILES notation for 1-diazo-8a,9a-dihydro-4H-fluoren-9-one?
The canonical SMILES for 1-diazo-8a,9a-dihydro-4H-fluoren-9-one is [N-]=[N+]=C1C=CCC2=C3C=CC=CC3C(=O)C12.
What is the InChIKey of 1-diazo-8a,9a-dihydro-4H-fluoren-9-one?
The InChIKey is UJFVOCITFITNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c14-15-11-7-3-6-9-8-4-1-2-5-10(8)13(16)12(9)11/h1-5,7,10,12H,6H2.
What are the key properties of 1-diazo-8a,9a-dihydro-4H-fluoren-9-one?
1-diazo-8a,9a-dihydro-4H-fluoren-9-one has a molecular weight of 210.24 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-8a,9a-dihydro-4H-fluoren-9-one is sourced from PubChem (CID 87376395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).