About 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate
1-ethyl-3-methylimidazol-3-ium;prop-2-enoate (PubChem CID 87377017) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate |
| PubChem CID | 87377017 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate |
| SMILES | C=CC(=O)[O-].CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C6H11N2.C3H4O2/c1-3-8-5-4-7(2)6-8;1-2-3(4)5/h4-6H,3H2,1-2H3;2H,1H2,(H,4,5)/q+1;/p-1 |
| InChIKey | CTBIETVPIVJBFC-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate (CID 87377017) is 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate is C=CC(=O)[O-].CCn1cc[n+](C)c1.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate?
The InChIKey is CTBIETVPIVJBFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.C3H4O2/c1-3-8-5-4-7(2)6-8;1-2-3(4)5/h4-6H,3H2,1-2H3;2H,1H2,(H,4,5)/q+1;/p-1.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate?
1-ethyl-3-methylimidazol-3-ium;prop-2-enoate has a molecular weight of 182.22 g/mol, XLogP of -0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;prop-2-enoate is sourced from PubChem (CID 87377017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).