About N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide
N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide (PubChem CID 87377333) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide.
Molecular Properties
| Compound Name | N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide |
| PubChem CID | 87377333 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide |
| SMILES | C1=CNC2=NC=C(N=C21)NC=O |
| InChI | InChI=1S/C7H6N4O/c12-4-10-6-3-9-7-5(11-6)1-2-8-7/h1-4H,(H,8,9)(H,10,11,12) |
| InChIKey | SJNXTBRYACWZOX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 70.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 175 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide?
The IUPAC name of N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide (CID 87377333) is N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide.
What is the SMILES notation for N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide?
The canonical SMILES for N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide is C1=CNC2=NC=C(N=C21)NC=O.
What is the InChIKey of N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide?
The InChIKey is SJNXTBRYACWZOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c12-4-10-6-3-9-7-5(11-6)1-2-8-7/h1-4H,(H,8,9)(H,10,11,12).
What are the key properties of N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide?
N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide has a molecular weight of 162.15 g/mol, XLogP of -0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5H-pyrrolo[2,3-b]pyrazin-2-yl)formamide is sourced from PubChem (CID 87377333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).