C13H15N3O2 — CID 87377429
6-amino-N-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 87377429) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-amino-N-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 6-amino-N-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 87377429 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-amino-N-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | NC1CCc2[nH]c3ccc(C(=O)NO)cc3c2C1 |
| InChI | InChI=1S/C13H15N3O2/c14-8-2-4-12-10(6-8)9-5-7(13(17)16-18)1-3-11(9)15-12/h1,3,5,8,15,18H,2,4,6,14H2,(H,16,17) |
| InChIKey | WOFAHTIXBKKAHS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|