About 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane
4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane (PubChem CID 87377535) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane.
Molecular Properties
| Compound Name | 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane |
| PubChem CID | 87377535 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane |
| SMILES | CC1CC(C2CO2)OC(C2CO2)O1 |
| InChI | InChI=1S/C9H14O4/c1-5-2-6(7-3-10-7)13-9(12-5)8-4-11-8/h5-9H,2-4H2,1H3 |
| InChIKey | YWGSYRBMNOJEDK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane?
The IUPAC name of 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane (CID 87377535) is 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane.
What is the SMILES notation for 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane?
The canonical SMILES for 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane is CC1CC(C2CO2)OC(C2CO2)O1.
What is the InChIKey of 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane?
The InChIKey is YWGSYRBMNOJEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-5-2-6(7-3-10-7)13-9(12-5)8-4-11-8/h5-9H,2-4H2,1H3.
What are the key properties of 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane?
4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane has a molecular weight of 186.21 g/mol, XLogP of 0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-bis(oxiran-2-yl)-1,3-dioxane is sourced from PubChem (CID 87377535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).