About N'-amino-2-methyl-N'-pentylprop-2-enehydrazide
N'-amino-2-methyl-N'-pentylprop-2-enehydrazide (PubChem CID 87377554) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is N'-amino-2-methyl-N'-pentylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N'-amino-2-methyl-N'-pentylprop-2-enehydrazide |
| PubChem CID | 87377554 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N'-amino-2-methyl-N'-pentylprop-2-enehydrazide |
| SMILES | C=C(C)C(=O)NN(N)CCCCC |
| InChI | InChI=1S/C9H19N3O/c1-4-5-6-7-12(10)11-9(13)8(2)3/h2,4-7,10H2,1,3H3,(H,11,13) |
| InChIKey | WITKQKWNAQZRFM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-2-methyl-N'-pentylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-2-methyl-N'-pentylprop-2-enehydrazide?
The IUPAC name of N'-amino-2-methyl-N'-pentylprop-2-enehydrazide (CID 87377554) is N'-amino-2-methyl-N'-pentylprop-2-enehydrazide.
What is the SMILES notation for N'-amino-2-methyl-N'-pentylprop-2-enehydrazide?
The canonical SMILES for N'-amino-2-methyl-N'-pentylprop-2-enehydrazide is C=C(C)C(=O)NN(N)CCCCC.
What is the InChIKey of N'-amino-2-methyl-N'-pentylprop-2-enehydrazide?
The InChIKey is WITKQKWNAQZRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-4-5-6-7-12(10)11-9(13)8(2)3/h2,4-7,10H2,1,3H3,(H,11,13).
What are the key properties of N'-amino-2-methyl-N'-pentylprop-2-enehydrazide?
N'-amino-2-methyl-N'-pentylprop-2-enehydrazide has a molecular weight of 185.27 g/mol, XLogP of 0.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-2-methyl-N'-pentylprop-2-enehydrazide is sourced from PubChem (CID 87377554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).