C16H15BrN2OS — CID 87377730
1-phenyl-2-(1,3-thiazol-3-ium-3-yl)ethanone;pyridine;bromide (PubChem CID 87377730) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 1-phenyl-2-(1,3-thiazol-3-ium-3-yl)ethanone;pyridine;bromide.
| Compound Name | 1-phenyl-2-(1,3-thiazol-3-ium-3-yl)ethanone;pyridine;bromide |
|---|---|
| PubChem CID | 87377730 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-phenyl-2-(1,3-thiazol-3-ium-3-yl)ethanone;pyridine;bromide |
| SMILES | O=C(C[n+]1ccsc1)c1ccccc1.[Br-].c1ccncc1 |
| InChI | InChI=1S/C11H10NOS.C5H5N.BrH/c13-11(8-12-6-7-14-9-12)10-4-2-1-3-5-10;1-2-4-6-5-3-1;/h1-7,9H,8H2;1-5H;1H/q+1;;/p-1 |
| InChIKey | RHVWPXLXLSWAKR-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 33.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|