About 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile
3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile (PubChem CID 87377774) has the molecular formula C19H18N4OS
and a molecular weight of 350.45 g/mol. Its IUPAC name is 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile.
Molecular Properties
| Compound Name | 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile |
| PubChem CID | 87377774 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile |
| SMILES | CCNc1c(C#N)cccc1/N=C1/SCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N4OS/c1-2-21-18-15(11-20)9-6-10-16(18)22-19-23(17(24)13-25-19)12-14-7-4-3-5-8-14/h3-10,21H,2,12-13H2,1H3/b22-19+ |
| InChIKey | LGYLLXBWYXROKT-ZBJSNUHESA-N |
| XLogP | 3.75 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile?
The IUPAC name of 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile (CID 87377774) is 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile.
What is the SMILES notation for 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile?
The canonical SMILES for 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile is CCNc1c(C#N)cccc1/N=C1/SCC(=O)N1Cc1ccccc1.
What is the InChIKey of 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile?
The InChIKey is LGYLLXBWYXROKT-ZBJSNUHESA-N. The full InChI is InChI=1S/C19H18N4OS/c1-2-21-18-15(11-20)9-6-10-16(18)22-19-23(17(24)13-25-19)12-14-7-4-3-5-8-14/h3-10,21H,2,12-13H2,1H3/b22-19+.
What are the key properties of 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile?
3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile has a molecular weight of 350.45 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-benzyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(ethylamino)benzonitrile is sourced from PubChem (CID 87377774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).