C15H19BrClNO4 — CID 8737778
[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(2-bromo-4-chlorophenoxy)acetate (PubChem CID 8737778) has the molecular formula C15H19BrClNO4 and a molecular weight of 392.68 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(2-bromo-4-chlorophenoxy)acetate.
| Compound Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(2-bromo-4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8737778 |
| Molecular Formula | C15H19BrClNO4 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(2-bromo-4-chlorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(Cl)cc1Br)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H19BrClNO4/c1-9(14(20)18-15(2,3)4)22-13(19)8-21-12-6-5-10(17)7-11(12)16/h5-7,9H,8H2,1-4H3,(H,18,20)/t9-/m0/s1 |
| InChIKey | SRWYPKNJMUYEPJ-VIFPVBQESA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |