C15H9ClF8N4O3 — CID 87378000
methyl 2-chloro-5-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylate (PubChem CID 87378000) has the molecular formula C15H9ClF8N4O3 and a molecular weight of 480.70 g/mol. Its IUPAC name is methyl 2-chloro-5-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-chloro-5-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87378000 |
| Molecular Formula | C15H9ClF8N4O3 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | methyl 2-chloro-5-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn2C)cnc1Cl |
| InChI | InChI=1S/C15H9ClF8N4O3/c1-28-8(7(14(19,20)21)9(27-28)13(17,18)15(22,23)24)11(29)26-5-3-6(12(30)31-2)10(16)25-4-5/h3-4H,1-2H3,(H,26,29) |
| InChIKey | DMHHBNMIENMGNR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|