C17H11F10N5O2 — CID 87378036
N-(2,2-difluorocyclopropyl)-4-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 87378036) has the molecular formula C17H11F10N5O2 and a molecular weight of 507.29 g/mol. Its IUPAC name is N-(2,2-difluorocyclopropyl)-4-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | N-(2,2-difluorocyclopropyl)-4-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87378036 |
| Molecular Formula | C17H11F10N5O2 |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-(2,2-difluorocyclopropyl)-4-[[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole-5-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1C(=O)Nc1ccnc(C(=O)NC2CC2(F)F)c1 |
| InChI | InChI=1S/C17H11F10N5O2/c1-32-10(9(16(22,23)24)11(31-32)15(20,21)17(25,26)27)13(34)29-6-2-3-28-7(4-6)12(33)30-8-5-14(8,18)19/h2-4,8H,5H2,1H3,(H,30,33)(H,28,29,34) |
| InChIKey | KNFYQVYKSQCJSJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|