C29H38O10P2 — CID 87378214
[3-[2,3-bis(prop-2-enyl)phenoxy]-3-[2,3-bis(prop-2-enyl)phenyl]-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate (PubChem CID 87378214) has the molecular formula C29H38O10P2 and a molecular weight of 608.56 g/mol. Its IUPAC name is [3-[2,3-bis(prop-2-enyl)phenoxy]-3-[2,3-bis(prop-2-enyl)phenyl]-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate.
| Compound Name | [3-[2,3-bis(prop-2-enyl)phenoxy]-3-[2,3-bis(prop-2-enyl)phenyl]-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87378214 |
| Molecular Formula | C29H38O10P2 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [3-[2,3-bis(prop-2-enyl)phenoxy]-3-[2,3-bis(prop-2-enyl)phenyl]-2,2-bis(hydroxymethyl)propyl] phosphono hydrogen phosphate |
| SMILES | C=CCc1cccc(OC(c2cccc(CC=C)c2CC=C)C(CO)(CO)COP(=O)(O)OP(=O)(O)O)c1CC=C |
| InChI | InChI=1S/C29H38O10P2/c1-5-11-22-15-9-17-26(24(22)13-7-3)28(38-27-18-10-16-23(12-6-2)25(27)14-8-4)29(19-30,20-31)21-37-41(35,36)39-40(32,33)34/h5-10,15-18,28,30-31H,1-4,11-14,19-21H2,(H,35,36)(H2,32,33,34) |
| InChIKey | TWCJEUOVPOXBGX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|