C8H4BrF7N2O3 — CID 87378314
[4-bromo-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl] hydrogen carbonate (PubChem CID 87378314) has the molecular formula C8H4BrF7N2O3 and a molecular weight of 389.02 g/mol. Its IUPAC name is [4-bromo-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl] hydrogen carbonate.
| Compound Name | [4-bromo-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87378314 |
| Molecular Formula | C8H4BrF7N2O3 |
| Molecular Weight | 389.02 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | [4-bromo-3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl] hydrogen carbonate |
| SMILES | Cn1nc(C(F)(F)C(F)(F)C(F)(F)F)c(Br)c1OC(=O)O |
| InChI | InChI=1S/C8H4BrF7N2O3/c1-18-4(21-5(19)20)2(9)3(17-18)6(10,11)7(12,13)8(14,15)16/h1H3,(H,19,20) |
| InChIKey | FTHDVTXXLAKWKB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|