About 1-pentyl-1,2-bis(prop-2-enyl)hydrazine
1-pentyl-1,2-bis(prop-2-enyl)hydrazine (PubChem CID 87378355) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-pentyl-1,2-bis(prop-2-enyl)hydrazine.
Molecular Properties
| Compound Name | 1-pentyl-1,2-bis(prop-2-enyl)hydrazine |
| PubChem CID | 87378355 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-pentyl-1,2-bis(prop-2-enyl)hydrazine |
| SMILES | C=CCNN(CC=C)CCCCC |
| InChI | InChI=1S/C11H22N2/c1-4-7-8-11-13(10-6-3)12-9-5-2/h5-6,12H,2-4,7-11H2,1H3 |
| InChIKey | KPGOIJMWJHAQPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-1,2-bis(prop-2-enyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-1,2-bis(prop-2-enyl)hydrazine?
The IUPAC name of 1-pentyl-1,2-bis(prop-2-enyl)hydrazine (CID 87378355) is 1-pentyl-1,2-bis(prop-2-enyl)hydrazine.
What is the SMILES notation for 1-pentyl-1,2-bis(prop-2-enyl)hydrazine?
The canonical SMILES for 1-pentyl-1,2-bis(prop-2-enyl)hydrazine is C=CCNN(CC=C)CCCCC.
What is the InChIKey of 1-pentyl-1,2-bis(prop-2-enyl)hydrazine?
The InChIKey is KPGOIJMWJHAQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-7-8-11-13(10-6-3)12-9-5-2/h5-6,12H,2-4,7-11H2,1H3.
What are the key properties of 1-pentyl-1,2-bis(prop-2-enyl)hydrazine?
1-pentyl-1,2-bis(prop-2-enyl)hydrazine has a molecular weight of 182.31 g/mol, XLogP of 2.36, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-1,2-bis(prop-2-enyl)hydrazine is sourced from PubChem (CID 87378355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).